
CAS 23175-16-8
:α-[[(2-Hydroxyethyl)methylamino]methyl]benzenemethanol
Description:
α-[[(2-Hydroxyethyl)methylamino]methyl]benzenemethanol, with the CAS number 23175-16-8, is a chemical compound characterized by its complex structure that includes a benzene ring, a hydroxyl group, and an amino group. This compound typically exhibits properties associated with both alcohols and amines, such as solubility in polar solvents due to the presence of hydroxyl and amino functional groups. It may display moderate to high polarity, influencing its interactions in biological systems and potential applications in pharmaceuticals or as a surfactant. The presence of the hydroxyethyl and methylamino groups suggests that it could participate in hydrogen bonding, which may affect its reactivity and stability. Additionally, the compound's structure may allow for various functional modifications, making it versatile in synthetic chemistry. Its specific applications and behavior in different environments would depend on further empirical studies, including its reactivity, toxicity, and potential uses in various industrial or medicinal contexts.
Formula:C11H17NO2
InChI:InChI=1S/C11H17NO2/c1-12(7-8-13)9-11(14)10-5-3-2-4-6-10/h2-6,11,13-14H,7-9H2,1H3
InChI key:InChIKey=DTYODHRLIDBIOC-UHFFFAOYSA-N
SMILES:C(CN(CCO)C)(O)C1=CC=CC=C1
Synonyms:- N-(2-Hydroxyethyl)-N-methyl-2-hydroxy-2-phenylethylamine
- Benzenemethanol, α-[[(2-hydroxyethyl)methylamino]methyl]-
- α-[[(2-Hydroxyethyl)methylamino]methyl]benzenemethanol
- Benzyl alcohol, α-[[(2-hydroxyethyl)methylamino]methyl]-
- 2-[(2-Hydroxyethyl)(methyl)amino]-1-phenylethan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
