CAS 23185-94-6
:17,23-epoxyveratraman-3-yl hexopyranoside
Description:
17,23-epoxyveratraman-3-yl hexopyranoside is a chemical compound that belongs to the class of alkaloids, specifically derived from the veratrum plant family. This compound features a complex structure characterized by an epoxy group, which contributes to its reactivity and potential biological activity. The presence of a hexopyranoside moiety indicates that it is a glycoside, suggesting that it may exhibit properties related to carbohydrate chemistry, such as solubility in water and potential interactions with biological systems. The epoxy group can enhance the compound's ability to participate in various chemical reactions, making it of interest in medicinal chemistry and pharmacology. Additionally, compounds like this one may exhibit various pharmacological effects, including anti-inflammatory or anti-cancer properties, although specific biological activities would require further investigation. Overall, 17,23-epoxyveratraman-3-yl hexopyranoside represents a unique structure with potential applications in drug development and natural product chemistry.
Formula:C33H51NO7
InChI:InChI=1/C33H51NO7/c1-16-11-25-27(34-14-16)18(3)33(41-25)10-8-21-22-6-5-19-12-20(7-9-32(19,4)24(22)13-23(21)17(33)2)39-31-30(38)29(37)28(36)26(15-35)40-31/h5,16,18,20-22,24-31,34-38H,6-15H2,1-4H3
SMILES:CC1CC2C(C(C)C3(CCC4C5CC=C6CC(CCC6(C)C5CC4=C3C)OC3C(C(C(C(CO)O3)O)O)O)O2)NC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cycloposine
CAS:<p>Cycloposine, a steroidal alkaloid present in the roots and rhizomes of Veratrum californicum, is known to possess teratogenic properties.</p>Formula:C33H51NO7Color and Shape:SolidMolecular weight:573.771

