CAS 23186-96-1: 5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione
Description:5-Methyl-5-(4-methylphenyl)imidazolidine-2,4-dione, with the CAS number 23186-96-1, is a chemical compound characterized by its imidazolidine structure, which features a five-membered ring containing two nitrogen atoms. This compound is a derivative of imidazolidine-2,4-dione, commonly known as a diketopiperazine. It exhibits properties typical of cyclic ureas, including potential applications in pharmaceuticals and organic synthesis. The presence of the methyl and para-methylphenyl substituents contributes to its unique chemical behavior, influencing solubility, reactivity, and potential biological activity. The compound may participate in various chemical reactions, such as nucleophilic substitutions or cyclization processes, due to the functional groups present. Additionally, its structural characteristics may allow for interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed in detail.
Formula:C11H12N2O2
InChI:InChI=1/C11H12N2O2/c1-7-3-5-8(6-4-7)11(2)9(14)12-10(15)13-11/h3-6H,1-2H3,(H2,12,13,14,15)
