CAS 231953-38-1
:3-fluoro-4-(trifluoromethyl)benzonitrile
Description:
3-Fluoro-4-(trifluoromethyl)benzonitrile is an aromatic compound characterized by the presence of a benzonitrile moiety, which features a cyano group (-C≡N) attached to a benzene ring. The compound has a fluorine atom at the meta position (3-fluoro) and a trifluoromethyl group (-CF3) at the para position (4-(trifluoromethyl)). This substitution pattern contributes to its unique electronic properties, making it a polar molecule with potential applications in pharmaceuticals and agrochemicals. The trifluoromethyl group is known for enhancing lipophilicity and metabolic stability, while the cyano group can participate in various chemical reactions, including nucleophilic additions. The presence of fluorine atoms generally increases the compound's stability and alters its reactivity compared to non-fluorinated analogs. Additionally, the compound's physical properties, such as melting point and solubility, are influenced by its functional groups and overall molecular structure. Overall, 3-fluoro-4-(trifluoromethyl)benzonitrile is a valuable compound in synthetic organic chemistry and material science.
Formula:C8H3F4N
InChI:InChI=1/C8H3F4N/c9-7-3-5(4-13)1-2-6(7)8(10,11)12/h1-3H
SMILES:c1cc(c(cc1C#N)F)C(F)(F)F
Synonyms:- 4-Cyano-2-fluorobenzotrifluoride~alpha,alpha,alpha,3-Tetrafluoro-p-tolunitrile
- 2,2,2-Trifluoroethyl Trichloromethanesulfonate
- Fluorotrifluoromethylbenzonitrile
- 4-Cyano-2-Fluorobenzotrifluoride
- à,à,à,3-tetrafluoro-p-tolunitrile
- 3-FLUORO-4-(TRIFLUOROMETHYL)BENZONITRILE
- 3-Fluoro-4-(trifluoromethyl)benzonitrile 97%
- 3-FLUORO-4-(TRIFLUOROMETHYL)BENZONITRILE/A,A,A,3-TETRAFLUORO-P-TOLUNITRILE
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Fluoro-4-(trifluoromethyl)benzonitrile
CAS:Formula:C8H3F4NPurity:>99.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:189.11Benzonitrile, 3-fluoro-4-(trifluoromethyl)-
CAS:Formula:C8H3F4NPurity:97%Color and Shape:SolidMolecular weight:189.10973-Fluoro-4-(trifluoromethyl)benzonitrile
CAS:3-Fluoro-4-(trifluoromethyl)benzonitrileFormula:C8H3F4NPurity:97%Color and Shape:SolidMolecular weight:189.11g/mol3-Fluoro-4-(trifluoromethyl)benzonitrile
CAS:<p>3-Fluoro-4-(trifluoromethyl)benzonitrile is a chemical compound with biological activity. It is structurally related to anthelmintics, and has been shown to be nematocidal in laboratory experiments. 3-Fluoro-4-(trifluoromethyl)benzonitrile has not been evaluated for safety or efficacy in humans.<br>!--END--></p>Formula:C8H3F4NPurity:Min. 95%Color and Shape:PowderMolecular weight:189.11 g/mol3-Fluoro-4-(trifluoromethyl)benzonitrile
CAS:Formula:C8H3F4NPurity:97%Color and Shape:SolidMolecular weight:189.1133-Fluoro-4-(trifluoromethyl)benzonitrile
CAS:Controlled Product<p>Applications 3-Fluoro-4-(trifluoromethyl)benzonitrile is a reactant in the synthesis of amino-acetonitrile derivatives. as a new class of synthetic anthelmintic compounds.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Ducray, P., et. al.: Bioorg. Med. Chem. Lett., 18, 2935 (2008)<br></p>Formula:C8H3F4NColor and Shape:NeatMolecular weight:189.11






