CAS 231953-40-5
:1-[3-chloro-5-(trifluoromethyl)-2-pyridyl]-1,4-diazepane
Description:
1-[3-Chloro-5-(trifluoromethyl)-2-pyridyl]-1,4-diazepane is a chemical compound characterized by its unique structure, which includes a diazepane ring and a pyridine moiety substituted with a chlorine atom and a trifluoromethyl group. The presence of the trifluoromethyl group enhances the lipophilicity and biological activity of the compound, making it of interest in medicinal chemistry. The chlorine atom contributes to the compound's reactivity and potential interactions with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific receptors or enzymes. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be influenced by the presence of the halogen and trifluoromethyl substituents, which can affect its stability and reactivity. Overall, this compound represents a class of heterocyclic compounds with potential utility in various chemical and biological applications.
Formula:C11H13ClF3N3
InChI:InChI=1/C11H13ClF3N3/c12-9-6-8(11(13,14)15)7-17-10(9)18-4-1-2-16-3-5-18/h6-7,16H,1-5H2
SMILES:C1CNCCN(C1)c1c(cc(cn1)C(F)(F)F)Cl
Synonyms:- 1-[3-Chloro-5-(Trifluoromethyl)Pyridin-2-Yl]-1,4-Diazepane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(3-Chloro-5-trifluoromethyl-2-pyridyl)homopiperazine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H13ClF3N3Purity:98%Molecular weight:279.691-(3-Chloro-5-(trifluoromethyl)pyridin-2-yl)-1,4-diazepane
CAS:Formula:C11H13ClF3N3Color and Shape:SolidMolecular weight:279.68921-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]homopiperazine
CAS:1-[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]homopiperazineFormula:C11H13ClF3N3Purity:97%Color and Shape: yellow/ pale brown liquidMolecular weight:279.69g/mol1-[3-Chloro-5-(trifluoromethyl)pyrid-2-yl]-1,4-diazepane
CAS:Formula:C11H13ClF3N3Purity:98.0%Color and Shape:LiquidMolecular weight:279.69



