CAS 2320-30-1

(3R,5S)-3,5-dimethylcyclohexanone

Description:

(3R,5S)-3,5-dimethylcyclohexanone is a cyclic ketone characterized by its unique stereochemistry and structural features. It contains a cyclohexane ring with two methyl groups attached at the 3 and 5 positions, contributing to its chiral nature. The presence of the ketone functional group (C=O) indicates that it exhibits typical reactivity associated with ketones, such as nucleophilic addition reactions. This compound is typically a colorless to pale yellow liquid with a distinctive odor, which is common among many ketones. Its molecular structure allows for various conformations due to the flexibility of the cyclohexane ring, influencing its physical properties such as boiling point and solubility. Additionally, the stereochemistry plays a crucial role in determining its interactions in biological systems and its potential applications in organic synthesis and pharmaceuticals. As with many organic compounds, safety precautions should be observed when handling (3R,5S)-3,5-dimethylcyclohexanone, as it may pose health risks if ingested or inhaled.

Formula: C₈H₁₄O

InChI: InChI=1/C8H14O/c1-6-3-7(2)5-8(9)4-6/h6-7H,3-5H2,1-2H3/t6-,7+

Synonyms:

• cis-3,5-Dimethylcyclohexanone
• cyclohexanone, 3,5-dimethyl-, (3R,5S)-
• Cyclohexanone, 3,5-dimethyl-, cis-
• (3R,5S)-3,5-Dimethylcyclohexanone

Cyclohexanone, 3,​5-​dimethyl-

CAS: 2320-30-1

Formula: C₈H₁₄O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 126.1962

Ref: IN-DA002MI5

3,5-Dimethylcyclohexanone (mixture of isomers)

CAS: 2320-30-1

Formula: C₈H₁₄O

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 126.20

Ref: 3B-D1282

3,5-Dimethylcyclohexanone

CAS: 2320-30-1

3,5-Dimethylcyclohexanone

Purity: 98%

Molecular weight: 126.20g/mol

Ref: 54-OR938239

3,5-Dimethylcyclohexanone

CAS: 2320-30-1

Formula: C₈H₁₄O

Purity: 97%

Color and Shape: Liquid, Clear

Molecular weight: 126.199

Ref: 10-F208730