CymitQuimica logo

CAS 23205-67-6

:

8-fluoro-9-pentofuranosyl-9H-purin-6-amine

Description:
8-Fluoro-9-pentofuranosyl-9H-purin-6-amine, with the CAS number 23205-67-6, is a synthetic nucleoside analog that exhibits structural similarities to natural purine nucleosides. This compound features a fluorine atom at the 8-position of the purine ring, which can influence its biological activity and stability. The pentofuranosyl moiety indicates that it contains a five-membered sugar ring, which is crucial for its incorporation into nucleic acids. This compound is of interest in medicinal chemistry and virology, particularly for its potential antiviral properties. The presence of the amino group at the 6-position of the purine ring may enhance its interaction with biological targets, such as enzymes involved in nucleic acid metabolism. Additionally, the fluorine substitution can affect the compound's lipophilicity and cellular uptake. Overall, 8-fluoro-9-pentofuranosyl-9H-purin-6-amine represents a valuable structure for research into nucleoside analogs and their therapeutic applications.
Formula:C10H12FN5O4
InChI:InChI=1/C10H12FN5O4/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,13,14)
SMILES:C(C1C(C(C(n2c3c(c(N)ncn3)nc2F)O1)O)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.