CAS 23210-56-2: Ifenprodil
Description:Ifenprodil is a chemical compound primarily recognized for its role as a neuroprotective agent and its potential therapeutic applications in treating neurological disorders. It is classified as a non-competitive antagonist of the NMDA (N-methyl-D-aspartate) receptor, which plays a crucial role in synaptic plasticity and memory function. Ifenprodil exhibits selectivity for certain NMDA receptor subtypes, particularly those containing the NR2B subunit, making it of interest in research related to neurodegenerative diseases and conditions associated with excitotoxicity. The compound is typically administered in its hydrochloride salt form and is known for its ability to modulate glutamatergic neurotransmission. Additionally, Ifenprodil has been studied for its potential effects on cardiovascular health, as it may influence vascular smooth muscle function. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are important for understanding its efficacy and safety profile in clinical settings. Overall, Ifenprodil represents a significant area of interest in pharmacological research, particularly in the context of neuroprotection and related therapeutic strategies.
Formula:C21H27NO2
InChI:InChI=1S/C21H27NO2/c1-16(21(24)19-7-9-20(23)10-8-19)22-13-11-18(12-14-22)15-17-5-3-2-4-6-17/h2-10,16,18,21,23-24H,11-15H2,1H3
InChI key:InChIKey=UYNVMODNBIQBMV-UHFFFAOYSA-N
SMILES:OC1=CC=C(C=C1)C(O)C(N2CCC(CC=3C=CC=CC3)CC2)C
- Synonyms:
- 1-Methyl-2-hydroxy-2-(4-hydroxyphenyl)ethyl-1-(4-benzylpiperidine)
- 1-Piperidineethanol, 4-benzyl-α-(p-hydroxyphenyl)-β-methyl-
- 1-Piperidineethanol, Alpha-(4-Hydroxyphenyl)-Beta-Methyl-4-(Phenylmethyl)-
- 1-Piperidineethanol, α-(4-hydroxyphenyl)-β-methyl-4-(phenylmethyl)-
- 2-(4-Benzylpiperidino)-1-(1-hydroxyphenyl)-1-propanol
- 2-(4-Benzylpiperidino)-1-(4-hydroxyphenyl)-1-propanol
- 23210-56-2
- 4-Benzyl-a-(p-hydroxyphenyl)-b-methyl-1-piperidineethanol
- 4-[2-(4-Benzyl-1-pipéridinyl)-1-hydroxypropyl]phénol
- 4-[2-(4-Benzylpiperidin-1-Yl)-1-Hydroxypropyl]Phenol 2,3-Dihydroxybutanedioate (2:1)
- See more synonyms
- 4-[2-(4-Benzylpiperidin-1-yl)-1-hydroxypropyl]phenol
- 66157-43-5
- Rc 61-91
- α-(4-Hydroxyphenyl)-β-methyl-4-(phenylmethyl)-1-piperidineethanol
- Ifenprodil
