CAS 23210-58-4: Ifenprodil tartrate
Description:Ifenprodil tartrate is a chemical compound primarily known for its role as a neuroprotective agent and its potential applications in treating various neurological disorders. It is classified as a non-competitive antagonist of the NMDA (N-methyl-D-aspartate) receptor, which plays a crucial role in synaptic plasticity and memory function. The tartrate salt form enhances its solubility and stability, making it suitable for pharmaceutical formulations. Ifenprodil exhibits selectivity for certain receptor subtypes, which may contribute to its therapeutic effects while minimizing side effects. The compound is typically administered in a controlled dosage to ensure efficacy and safety. Its pharmacological profile suggests potential benefits in conditions such as ischemic brain injury and neurodegenerative diseases. However, further research is necessary to fully elucidate its mechanisms of action and therapeutic potential. As with any pharmaceutical agent, understanding its pharmacokinetics, interactions, and side effects is essential for effective clinical use.
Formula:C21H27NO2C4H6O6
InChI:InChI=1S/C21H27NO2.C4H6O6/c1-16(21(24)19-7-9-20(23)10-8-19)22-13-11-18(12-14-22)15-17-5-3-2-4-6-17;5-1(3(7)8)2(6)4(9)10/h2-10,16,18,21,23-24H,11-15H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1
InChI key:InChIKey=FFYMSFGBEJMSFP-LREBCSMRSA-N
SMILES:O=C(O)C(O)C(O)C(=O)O.OC1=CC=C(C=C1)C(O)C(N2CCC(CC=3C=CC=CC3)CC2)C
- Synonyms:
- 1-Piperidineethanol, 4-benzyl-α-(p-hydroxyphenyl)-β-methyl-, tartrate (salt)
- 1-Piperidineethanol, α-(4-hydroxyphenyl)-β-methyl-4-(phenylmethyl)-, (2R,3R)-2,3-dihydroxybutanedioate (2:1)
- 1-Piperidineethanol, α-(4-hydroxyphenyl)-β-methyl-4-(phenylmethyl)-, (2R,3R)-2,3-dihydroxybutanedioate (2:1) (salt)
- 1-Piperidineethanol, α-(4-hydroxyphenyl)-β-methyl-4-(phenylmethyl)-, [R-(R*,R*)]-2,3-dihydroxybutanedioate (2:1) (salt)
- 4-Benzyl-1-(beta,4-dihydroxy-alpha-methylphenethyl)piperidinium hydrogen tartrate
- 4-Benzyl-1-[1-Hydroxy-1-(4-Hydroxyphenyl)Propan-2-Yl]Piperidinium 3-Carboxy-2,3-Dihydroxypropanoate
- 4-[2-(4-Benzylpiperidin-1-Yl)-1-Hydroxypropyl]Phenol 2,3-Dihydroxybutanedioate (2:1)
- Ifenprodil <span class="text-smallcaps">L</span>-(+)-tartrate
- Ifenprodil tartrate
