CAS 23218-93-1

methyl 3-amino-5-nitrobenzoate

Description:

Methyl 3-amino-5-nitrobenzoate, with the CAS number 23218-93-1, is an organic compound that belongs to the class of benzoate esters. It features a methyl ester functional group attached to a benzoic acid derivative, which is further substituted with an amino group and a nitro group. The presence of the amino group (-NH2) indicates potential basic properties, while the nitro group (-NO2) contributes to its electron-withdrawing characteristics, influencing its reactivity and stability. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. The presence of both amino and nitro groups can also impart unique properties, such as the ability to participate in various chemical reactions, including nucleophilic substitutions and reductions. Safety data should be consulted for handling, as nitro compounds can be sensitive and potentially hazardous.

Formula: C₈H₈N₂O₄

InChI: InChI=1/C8H8N2O4/c1-14-8(11)5-2-6(9)4-7(3-5)10(12)13/h2-4H,9H2,1H3

SMILES: COC(=O)c1cc(cc(c1)N(=O)=O)N

Synonyms:

• Benzoic acid, 3-amino-5-nitro-, methyl ester
• Methyl 3-amino-5-nitrobenzoate

Benzoic acid, 3-amino-5-nitro-, methyl ester

CAS: 23218-93-1

Formula: C₈H₈N₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.1601

Ref: IN-DA002MK3

Methyl 3-amino-5-nitrobenzoate

CAS: 23218-93-1

Methyl 3-amino-5-nitrobenzoate

Formula: C₈H₈N₂O₄

Purity: 95%

Color and Shape: yellow to red powder

Molecular weight: 196.16g/mol

Ref: 54-OR0861

3-Amino-5-nitrobenzoic acid methyl ester

CAS: 23218-93-1

Formula: C₈H₈N₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.162

Ref: 10-F021285