CAS 23219-33-2
:2-amino-4-chloro-3-hydroxybenzoic acid
Description:
2-Amino-4-chloro-3-hydroxybenzoic acid, also known as 4-chloro-3-hydroxyanthranilic acid, is an aromatic compound characterized by the presence of an amino group (-NH2), a hydroxyl group (-OH), and a chloro substituent on a benzoic acid framework. This compound features a benzene ring with a carboxylic acid (-COOH) group, which contributes to its acidity and solubility in polar solvents. The amino group imparts basic properties, while the hydroxyl group can participate in hydrogen bonding, enhancing its reactivity and solubility in water. The chloro substituent affects the compound's electronic properties and can influence its biological activity. This substance is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential as an intermediate in the synthesis of other compounds. Its molecular structure allows for various interactions, making it a candidate for studies in medicinal chemistry and material science. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H6ClNO3
InChI:InChI=1/C7H6ClNO3/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,10H,9H2,(H,11,12)
SMILES:c1cc(c(c(c1C(=O)O)N)O)Cl
Synonyms:- Benzoic Acid, 2-Amino-4-Chloro-3-Hydroxy-
- 2-Amino-4-chloro-3-hydroxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 2-amino-4-chloro-3-hydroxy-
CAS:Formula:C7H6ClNO3Purity:95%Color and Shape:SolidMolecular weight:187.58042-Amino-4-chloro-3-hydroxybenzoic acid
CAS:2-Amino-4-chloro-3-hydroxybenzoic acidPurity:95%Molecular weight:187.58g/mol2-Amino-4-chloro-3-hydroxybenzoic acid
CAS:2-Amino-4-chloro-3-hydroxybenzoic acid is a compound that contains hydrogen fluoride and fluorine. It is commonly used in research chemicals and has various applications. This compound has been found to have antioxidant properties, which can help reduce lipid peroxidation and protect cells from oxidative damage. Additionally, it has been shown to have potential health benefits such as promoting the production of vitamin D3 and supporting the metabolism of fatty acids. 2-Amino-4-chloro-3-hydroxybenzoic acid can be found in certain plant extracts, including pterostilbene and caffeine, as well as in chloride, tyrosine, l-lysine, and oligosaccharides. Its unique characteristics make it a valuable ingredient in various industries.Formula:C7H6ClNO3Purity:Min. 95%Molecular weight:187.58 g/mol



