CymitQuimica logo

CAS 23220-74-8

:

2-hydroxy-1-(2,3,5-tri-O-benzoylpentofuranosyl)pyridin-4(1H)-one

Description:
2-Hydroxy-1-(2,3,5-tri-O-benzoylpentofuranosyl)pyridin-4(1H)-one, with the CAS number 23220-74-8, is a complex organic compound characterized by its unique structural features. It contains a pyridinone moiety, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the 2,3,5-tri-O-benzoyl group indicates that the compound has multiple aromatic benzoyl substituents, enhancing its lipophilicity and possibly its ability to interact with biological membranes. The hydroxyl group at the 2-position of the pyridinone adds to its reactivity and may participate in hydrogen bonding, influencing its solubility and stability. This compound is likely to exhibit interesting pharmacological properties due to its structural complexity, making it a subject of interest in research related to drug development and synthesis. Its synthesis typically involves multi-step organic reactions, and its characterization can be achieved through techniques such as NMR, mass spectrometry, and IR spectroscopy to confirm its molecular structure and purity.
Formula:C31H25NO9
InChI:InChI=1/C31H25NO9/c33-23-16-17-32(25(34)18-23)28-27(41-31(37)22-14-8-3-9-15-22)26(40-30(36)21-12-6-2-7-13-21)24(39-28)19-38-29(35)20-10-4-1-5-11-20/h1-18,24,26-28,34H,19H2
SMILES:c1ccc(cc1)C(=O)OCC1C(C(C(n2ccc(=O)cc2O)O1)OC(=O)c1ccccc1)OC(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.