CAS 232271-19-1: 2(S)-(2,6-Dichlorobenzamido)-3-(2',6'-dimethoxybiphenyl-4-yl)propionic acid
Description:2(S)-(2,6-Dichlorobenzamido)-3-(2',6'-dimethoxybiphenyl-4-yl)propionic acid, with CAS number 232271-19-1, is a synthetic organic compound characterized by its complex structure, which includes a propionic acid moiety, a dichlorobenzamide group, and a biphenyl derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with large aromatic systems. Its molecular structure suggests potential biological activity, possibly as a pharmaceutical agent, given the presence of functional groups that can interact with biological targets. The dichlorobenzamide component may contribute to its pharmacological properties, while the dimethoxybiphenyl moiety could enhance lipophilicity and bioavailability. As with many compounds of this nature, it is essential to consider its stability, reactivity, and potential toxicity in various environments. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry or as research tools in biological studies.
Formula:C24H21Cl2NO5
InChI:InChI=1S/C24H21Cl2NO5/c1-31-19-7-4-8-20(32-2)21(19)15-11-9-14(10-12-15)13-18(24(29)30)27-23(28)22-16(25)5-3-6-17(22)26/h3-12,18H,13H2,1-2H3,(H,27,28)(H,29,30)/t18-/m0/s1
InChI key:InChIKey=DRSJLVGDSNWQBI-SFHVURJKSA-N
SMILES:O=C(O)C(NC(=O)C=1C(Cl)=CC=CC1Cl)CC=2C=CC(=CC2)C=3C(OC)=CC=CC3OC
- Synonyms:
- (αS)-α-[(2,6-Dichlorobenzoyl)amino]-2′,6′-dimethoxy[1,1′-biphenyl]-4-propanoic acid
- N-(2,6-Dichlorobenzoyl)-3-(2',6'-dimethoxybiphenyl-4-yl)-L-alanine
- N-(2,6-Dichlorobenzoyl)-4-(2,6-dimethoxyphenyl)-L-phenylalanine
- Sb-683698
- Tr-14035
- [1,1′-Biphenyl]-4-propanoic acid, α-[(2,6-dichlorobenzoyl)amino]-2′,6′-dimethoxy-, (αS)-
![[1,1'-Biphenyl]-4-propanoic acid, α-[(2,6-dichlorobenzoyl)amino]-2',6'-dimethoxy-, (αS)-](https://static.cymitquimica.com/products/IN/thumb/DA002MKL.jpg)
![(S)-2-(2,6-Dichlorobenzamido)-3-(2Õ,6Õ-Dimethoxy-[1,1Õ-Biphenyl]-4-Yl)Propanoic Acid](https://static.cymitquimica.com/products/54/thumb/OR1024077.jpg)
