CAS 23228-45-7

2-Chloro-4-trifluoromethylbenzoic acid

Description:

2-Chloro-4-trifluoromethylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a chloro group and a trifluoromethyl group on a benzene ring. The molecular structure features a benzoic acid moiety, which includes a carboxylic acid functional group (-COOH) attached to a benzene ring. The chloro substituent is located at the second position, while the trifluoromethyl group (-CF3) is positioned at the fourth position of the benzene ring, contributing to the compound's unique reactivity and properties. This compound is typically a solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of agrochemicals and pharmaceuticals. Its trifluoromethyl group enhances lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Additionally, 2-Chloro-4-trifluoromethylbenzoic acid may exhibit specific biological activities, although detailed studies are necessary to fully understand its pharmacological profile. Proper handling and safety measures are essential due to its chemical nature.

Formula: C₈H₄ClF₃O₂

InChI: InChI=1/C8H4ClF3O2/c9-6-3-4(8(10,11)12)1-2-5(6)7(13)14/h1-3H,(H,13,14)

SMILES: c1cc(c(cc1C(F)(F)F)Cl)C(=O)O

Synonyms:

• 2-Chloro-4-(trifluoromethyl)benzoic acid

Benzoic acid, 2-chloro-4-(trifluoromethyl)-

CAS: 23228-45-7

Formula: C₈H₄ClF₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 224.5644

Ref: IN-DA002MLM

2-Chloro-4-(trifluoromethyl)benzoic acid

CAS: 23228-45-7

2-Chloro-4-(trifluoromethyl)benzoic acid

Formula: C₈H₄ClF₃O₂

Purity: 97%

Color and Shape: white. wooly powder

Molecular weight: 224.56g/mol

Ref: 54-PC48310

2-Chloro-4-trifluoromethylbenzoic acid

CAS: 23228-45-7

2-Chloro-4-trifluoromethylbenzoic acid is a chemical compound with the formula CHClFO. It can be obtained by deprotonation of 2,4,6-trichlorobenzoic acid with butyllithium and subsequent reaction with chlorotrifluoromethane. The product has two regioisomers, one in which the chlorine atom is attached to the para position on the benzene ring and the other in which it is attached to the ortho position. Substituents such as alkyl groups or lithium reagents can affect both reactivity and selectivity. The halogen substituent can also be replaced by other functional groups to make derivatives of this compound.

Formula: C₈H₄ClF₃O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 224.56 g/mol

Ref: 3D-FC15381

2-Chloro-4-(trifluoromethyl)benzoic acid

CAS: 23228-45-7

Formula: C₈H₄ClF₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 224.56

Ref: 10-F047146