CAS 23246-96-0: Riddelline
Description:Riddelline, with the CAS number 23246-96-0, is a naturally occurring alkaloid primarily derived from certain plant species, particularly those in the family of Amaryllidaceae. This compound is characterized by its complex bicyclic structure, which contributes to its biological activity. Riddelline exhibits a range of pharmacological properties, including potential neuroprotective effects and cytotoxicity against various cancer cell lines. Its mechanism of action is thought to involve interactions with cellular pathways, although specific details may vary based on the context of its use. Additionally, Riddelline has garnered interest in medicinal chemistry for its potential therapeutic applications, particularly in the fields of oncology and neurology. However, due to its bioactivity, careful consideration of dosage and potential side effects is essential in any application. As with many alkaloids, further research is necessary to fully elucidate its mechanisms and potential uses in medicine.
Formula:C18H23NO6
InChI:InChI=1S/C18H23NO6/c1-3-12-8-11(2)18(23,10-20)17(22)24-9-13-4-6-19-7-5-14(15(13)19)25-16(12)21/h3-4,14-15,20,23H,2,5-10H2,1H3/b12-3-/t14-,15-,18-/m1/s1
InChI key:InChIKey=SVCNNZDUGWLODJ-RAYFHMIRSA-N
SMILES:O=C1OC2CCN3CC=C(COC(=O)C(O)(C(=C)CC1=CC)CO)C32
- Synonyms:
- (15Z)-12,18-Dihydroxy-13,19-didehydrosenecionan-11,16-dione
- (3Z,6S,14aR,14bR)-3-Ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-(hydroxymethyl)-5-methylene[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione
- Riddeline
- Riddelliin
- Riddelliine
- Riddelline
- Senecionan-11,16-dione, 13,19-didehydro-12,18-dihydroxy-
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-(hydroxymethyl)-5-methylene-, [6S-(3Z,6R*,14aS*,14bS*)]-
- [1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-(hydroxymethyl)-5-methylene-, (3Z,6S,14aR,14bR)-
![[1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-de…](https://static.cymitquimica.com/products/IN/thumb/DA002MNB.jpg)
