CAS 232600-93-0

pyrazolo[1,5-a]pyrimidin-3-amine

Description:

Pyrazolo[1,5-a]pyrimidin-3-amine is a heterocyclic organic compound characterized by its fused pyrazole and pyrimidine rings. This compound features an amino group at the 3-position of the pyrimidine ring, which contributes to its reactivity and potential biological activity. It is typically a crystalline solid and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The structure of pyrazolo[1,5-a]pyrimidin-3-amine allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique ring system can influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, compounds of this class may exhibit diverse biological activities, including anti-inflammatory, anti-cancer, or anti-viral properties, depending on their specific substituents and structural modifications. As with many heterocycles, the synthesis and functionalization of pyrazolo[1,5-a]pyrimidin-3-amine can lead to a wide range of derivatives with tailored properties for research and therapeutic applications.

Formula: C₆H₆N₄

InChI: InChI=1/C6H6N4/c7-5-4-9-10-3-1-2-8-6(5)10/h1-4H,7H2

SMILES: c1cnc2c(cnn2c1)N

Synonyms:

• 3-Aminopyrazolo[1,5-a]pyrimidine

3-Aminopyrazolo[1,5-a]pyrimidine

CAS: 232600-93-0

Formula: C₆H₆N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 134.1386

Ref: IN-DA002MPE

3-Aminopyrazolo[1,5-a]pyrimidine

CAS: 232600-93-0

3-Aminopyrazolo[1,5-a]pyrimidine

Purity: 98%

Molecular weight: 134.14g/mol

Ref: 54-OR76994

Pyrazolo[1,5-a]pyrimidin-3-amine

CAS: 232600-93-0

Formula: C₆H₆N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 134.142

Ref: 10-F077602