CAS 23261-58-7
:5-Quinolinesulfonic acid
Description:
5-Quinolinesulfonic acid is an organic compound characterized by its quinoline structure, which features a nitrogen-containing bicyclic aromatic system. This compound is a sulfonic acid derivative, meaning it contains a sulfonic acid group (-SO3H) attached to the quinoline ring. It is typically a white to light yellow crystalline solid that is soluble in water and polar organic solvents, making it useful in various chemical applications. The presence of the sulfonic acid group enhances its acidity and reactivity, allowing it to participate in various chemical reactions, including sulfonation and nucleophilic substitutions. 5-Quinolinesulfonic acid is often utilized in the synthesis of dyes, pharmaceuticals, and as a reagent in organic chemistry. Additionally, it may exhibit biological activity, which can be of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as with many sulfonic acids, due to its corrosive nature and potential health hazards.
Formula:C9H7NO3S
InChI:InChI=1S/C9H7NO3S/c11-14(12,13)9-5-1-4-8-7(9)3-2-6-10-8/h1-6H,(H,11,12,13)
InChI key:InChIKey=KVGSJGNWRDPVKA-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C2=C(C=CC1)N=CC=C2
Synonyms:- 5-Quinolinesulfonic acid
- NSC 20844
- NSC 229329
- Quinoline-5-Sulfonic Acid
- Quinoline-5-sulphonic acid
- Fasudil impurity 1/Quinoline-5-sulfonic acid
- Einecs 245-538-9
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Fasudil Impurity 19
CAS:Formula:C9H7NO3SColor and Shape:White To Off-White SolidMolecular weight:209.22


