CymitQuimica logo

CAS 23263-96-9

:

3-(4-methoxyphenyl)-5-methyl-1H-pyrazole

Description:
3-(4-Methoxyphenyl)-5-methyl-1H-pyrazole, identified by its CAS number 23263-96-9, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a 4-methoxyphenyl group indicates that there is a methoxy substituent (-OCH3) attached to a phenyl ring at the para position relative to the pyrazole. Additionally, the methyl group (-CH3) at the 5-position of the pyrazole contributes to its structural diversity. This compound is typically studied for its potential biological activities, including anti-inflammatory and analgesic properties, owing to the presence of the pyrazole moiety, which is known for its pharmacological significance. The compound is likely to be a solid at room temperature and may exhibit moderate solubility in organic solvents. Its synthesis often involves reactions typical of heterocyclic chemistry, and it can be analyzed using techniques such as NMR and mass spectrometry to confirm its structure and purity.
Formula:C11H12N2O
InChI:InChI=1/C11H12N2O/c1-8-7-11(13-12-8)9-3-5-10(14-2)6-4-9/h3-7H,1-2H3,(H,12,13)
SMILES:Cc1cc(c2ccc(cc2)OC)n[nH]1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.