CAS 23274-21-7

5-amino-1-(2,3,5-tri-O-acetylpentofuranosyl)-1H-imidazole-4-carboxamide

Description:

5-amino-1-(2,3,5-tri-O-acetylpentofuranosyl)-1H-imidazole-4-carboxamide is a chemical compound characterized by its complex structure, which includes an imidazole ring and a pentofuranosyl moiety. The presence of the amino group and the carboxamide functional group contributes to its potential biological activity, making it of interest in medicinal chemistry. The tri-O-acetyl groups indicate that the hydroxyl groups on the pentofuranosyl sugar are acetylated, which can enhance the compound's solubility and stability. This modification may also influence its interaction with biological targets. The compound's CAS number, 23274-21-7, allows for its identification in chemical databases and literature. Overall, this substance may exhibit properties relevant to nucleoside analogs, potentially impacting its use in therapeutic applications, particularly in antiviral or anticancer research. Its synthesis and characterization would typically involve standard organic chemistry techniques, including protection and deprotection strategies for the sugar moiety.

Formula: C₁₅H₂₀N₄O₈

InChI: InChI=1/C15H20N4O8/c1-6(20)24-4-9-11(25-7(2)21)12(26-8(3)22)15(27-9)19-5-18-10(13(19)16)14(17)23/h5,9,11-12,15H,4,16H2,1-3H3,(H2,17,23)

SMILES: CC(=O)OCC1C(C(C(n2cnc(c2N)C(=N)O)O1)OC(=O)C)OC(=O)C

1H-Imidazole-4-carboxamide, 5-amino-1-(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)-

CAS: 23274-21-7

Formula: C₁₅H₂₀N₄O₈

Color and Shape: Solid

Molecular weight: 384.3413

Ref: IN-DA002MR4

5-Amino-1-(2’,3’,5’-tri-O-acetyl-b-D-ribofuranosyl)-imidazole-4-carboxamide

Controlled Product

CAS: 23274-21-7

Applications 5-Amino-1-(2’,3’,5’-tri-O-acetyl-β-D-ribofuranosyl)-imidazole-4-carboxamide (cas# 23274-21-7) is a compound useful in organic synthesis.

Formula: C₁₅H₂₀N₄O₈

Color and Shape: Neat

Molecular weight: 384.341

Ref: TR-A630670

5-Amino-1-(2',3',5'-tri-O-acetyl-b-D-ribofuranosyl)-imidazole-4-carboxamide

CAS: 23274-21-7

5-Amino-1-(2',3',5'-tri-O-acetyl-b-D-ribofuranosyl)-imidazole-4-carboxamide (AICAR) is a high purity novel nucleotide analog that has been shown to be an activator of AMPK. AICAR can act as a substitute for ATP, the molecule that drives cellular energy production. AICAR has been shown to inhibit tumor growth and induce apoptosis in cancer cells. This compound also inhibits viral RNA replication by competitively binding to the enzyme polymerase, which is essential for viral replication.

Formula: C₁₅H₂₀N₄O₈

Purity: Min. 95%

Molecular weight: 384.34 g/mol

Ref: 3D-NA11364