CAS 23279-64-3

4-[2-(N-Acetylamino)ethyl]acetophenone

Description:

4-[2-(N-Acetylamino)ethyl]acetophenone, also known by its CAS number 23279-64-3, is an organic compound characterized by its structure, which includes an acetophenone moiety and an N-acetylaminoethyl side chain. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic acetophenone component. The presence of the N-acetylamino group suggests that it may exhibit biological activity, potentially serving as a precursor in the synthesis of pharmaceuticals or other bioactive molecules. Its functional groups allow for various chemical reactions, including acylation and amide bond formation. Additionally, the compound may be of interest in research related to medicinal chemistry, particularly in the development of analgesics or anti-inflammatory agents. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1/C12H15NO2/c1-9(14)12-5-3-11(4-6-12)7-8-13-10(2)15/h3-6H,7-8H2,1-2H3,(H,13,15)

SMILES: CC(=O)c1ccc(cc1)CCN=C(C)O

Synonyms:

• N-[2-(4-acetylphenyl)ethyl]acetamide

N-[2-(4-Acetylphenyl)ethyl]acetamide

CAS: 23279-64-3

Versatile small molecule scaffold

Formula: C₁₂H₁₅NO₂

Purity: Min. 95%

Molecular weight: 205.25 g/mol

Ref: 3D-YAA27964