CymitQuimica logo

CAS 23280-39-9

:

2-chloro-N-[4-(dimethylsulfamoyl)phenyl]acetamide

Description:
2-Chloro-N-[4-(dimethylsulfamoyl)phenyl]acetamide, with the CAS number 23280-39-9, is a chemical compound characterized by its specific functional groups and structural features. It contains a chloro group, an acetamide moiety, and a dimethylsulfamoyl group attached to a phenyl ring. This compound is typically a solid at room temperature and is soluble in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the sulfonamide group, which is known for its biological activity. The chloro substituent may also influence its reactivity and interaction with biological targets. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be determined through various analytical techniques, including NMR and mass spectrometry. Overall, 2-chloro-N-[4-(dimethylsulfamoyl)phenyl]acetamide represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H13ClN2O3S
InChI:InChI=1/C10H13ClN2O3S/c1-13(2)17(15,16)9-5-3-8(4-6-9)12-10(14)7-11/h3-6H,7H2,1-2H3,(H,12,14)
SMILES:CN(C)S(=O)(=O)c1ccc(cc1)NC(=O)CCl
Synonyms:
  • acetamide, 2-chloro-N-[4-[(dimethylamino)sulfonyl]phenyl]-
  • 2-Chloro-N-(4-dimethylsulfamoyl-phenyl)-acetamide
  • 2-Chloro-N-[4-(dimethylsulfamoyl)phenyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.