CAS 23289-10-3

2-(4-chlorophenyl)-1,3,4-oxadiazole

Description:

2-(4-Chlorophenyl)-1,3,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. The compound features a chlorophenyl group, indicating the presence of a chlorine atom attached to a phenyl ring at the para position relative to the oxadiazole moiety. This structure imparts specific chemical properties, including potential reactivity due to the electron-withdrawing nature of the chlorine substituent. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activities and applications in the development of novel compounds. The presence of the oxadiazole ring often correlates with properties such as fluorescence and antimicrobial activity, making it a subject of research in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₅ClN₂O

InChI: InChI=1/C8H5ClN2O/c9-7-3-1-6(2-4-7)8-11-10-5-12-8/h1-5H

SMILES: c1cc(ccc1c1nnco1)Cl

Synonyms:

• 1,3,4-Oxadiazole, 2-(4-Chlorophenyl)-

2-(4-CHLOROPHENYL)-1,3,4-OXADIAZOLE

CAS: 23289-10-3

Formula: C₈H₅ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.5911

Ref: IN-DA00BJT1

2-(4-Chlorophenyl)-1,3,4-oxadiazole

CAS: 23289-10-3

2-(4-Chlorophenyl)-1,3,4-oxadiazole

Purity: 95%

Molecular weight: 180.59g/mol

Ref: 54-OR954505

2-(4-Chlorophenyl)-1,3,4-oxadiazole

CAS: 23289-10-3

Formula: C₈H₅ClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 180.59

Ref: 10-F049236

2-(4-Chlorophenyl)-1,3,4-oxadiazole

CAS: 23289-10-3

2-(4-Chlorophenyl)-1,3,4-oxadiazole is a versatile compound that has various applications. It can be used as a eutectic solvent for fatty acids, collagen, and cellulose. Additionally, it can serve as a catalyst in the production of levulinic acid and triparanol from biomass. This compound is commonly used in research laboratories as a reagent for chemical reactions. It can also be utilized in analytical techniques such as sodium dodecyl sulfate-polyacrylamide gel electrophoresis (SDS-PAGE) to separate and analyze proteins. Furthermore, 2-(4-Chlorophenyl)-1,3,4-oxadiazole has potential applications in the field of ophthalmology due to its intraocular properties.

Formula: C₈H₅ClN₂O

Purity: Min. 95%

Molecular weight: 180.59 g/mol

Ref: 3D-YAA28910