CymitQuimica logo

CAS 232926-33-9

:

2-(methylsulfanyl)pyridine-3-carbohydrazide

Description:
2-(Methylsulfanyl)pyridine-3-carbohydrazide is an organic compound characterized by its pyridine ring, which is substituted at the 2-position with a methylsulfanyl group and at the 3-position with a carbohydrazide functional group. This compound typically exhibits properties associated with both heterocyclic and hydrazide functionalities, making it of interest in various chemical and biological applications. The presence of the methylsulfanyl group can influence its reactivity and solubility, while the carbohydrazide moiety may impart biological activity, potentially making it useful in medicinal chemistry. The compound is likely to be a solid at room temperature and may exhibit moderate polarity due to the presence of both sulfur and nitrogen atoms in its structure. Its synthesis may involve reactions typical of hydrazides and pyridine derivatives, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, 2-(methylsulfanyl)pyridine-3-carbohydrazide represents a unique chemical entity with potential applications in research and development.
Formula:C7H9N3OS
InChI:InChI=1/C7H9N3OS/c1-12-7-5(6(11)10-8)3-2-4-9-7/h2-4H,8H2,1H3,(H,10,11)
SMILES:CSc1c(cccn1)C(=O)NN
Synonyms:
  • 2-(Methylsulfanyl)nicotinohydrazide
  • 3-Pyridinecarboxylic acid, 2-(methylthio)-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.