CymitQuimica logo

CAS 232953-52-5

:

5-methyl-3-(3-{4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl}propyl)pyrimidine-2,4(1H,3H)-dione hydrochloride (1:1)

Description:
5-Methyl-3-(3-{4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl}propyl)pyrimidine-2,4(1H,3H)-dione hydrochloride is a synthetic organic compound characterized by its complex structure, which includes a pyrimidine core substituted with various functional groups. The presence of a methyl group and a piperazine moiety contributes to its potential biological activity, often associated with pharmacological properties. The trifluoroethoxy group enhances lipophilicity, which may influence the compound's solubility and permeability in biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, facilitating its use in pharmaceutical formulations. The compound's molecular interactions, including hydrogen bonding and hydrophobic interactions, are crucial for its biological efficacy. Its specific applications may involve research in medicinal chemistry, particularly in the development of therapeutics targeting neurological or psychiatric disorders, given the piperazine structure's common association with such activities. Overall, this compound exemplifies the intricate design often employed in drug development to optimize pharmacological profiles.
Formula:C20H26ClF3N4O3
InChI:InChI=1/C20H25F3N4O3.ClH/c1-15-13-24-19(29)27(18(15)28)8-4-7-25-9-11-26(12-10-25)16-5-2-3-6-17(16)30-14-20(21,22)23;/h2-3,5-6,13H,4,7-12,14H2,1H3,(H,24,29);1H
SMILES:Cc1cnc(n(CCCN2CCN(CC2)c2ccccc2OCC(F)(F)F)c1=O)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.