CAS 23299-13-0

1-(4-Chlorophenyl)-2-(isopropylamino)ethanol

Description:

1-(4-Chlorophenyl)-2-(isopropylamino)ethanol, also known by its CAS number 23299-13-0, is a chemical compound characterized by its structure, which includes a chlorophenyl group and an isopropylamino group attached to an ethanol backbone. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including potential solubility in organic solvents and moderate polarity due to the hydroxyl group. It may display biological activity, particularly in pharmacological contexts, as compounds with similar structures are often investigated for their effects on neurotransmitter systems. The presence of the chlorophenyl moiety can influence its reactivity and interaction with biological targets. Additionally, the isopropylamino group may contribute to its basicity and potential for forming salts. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound's unique structural features suggest it could be of interest in medicinal chemistry and related fields.

Formula: C₁₁H₁₆ClNO

InChI: InChI=1/C11H16ClNO/c1-8(2)13-7-11(14)9-3-5-10(12)6-4-9/h3-6,8,11,13-14H,7H2,1-2H3

SMILES: CC(C)NCC(c1ccc(cc1)Cl)O

Synonyms:

• Benzenemethanol, 4-Chloro-Α-[[(1-Methylethyl)Amino]Methyl]-

1-(4-chlorophenyl)-2-[(propan-2-yl)amino]ethan-1-ol

CAS: 23299-13-0

Formula: C₁₁H₁₆ClNO

Purity: 98%

Molecular weight: 213.7038

Ref: IN-DA002MTG