CAS 233-56-7

1H-Imidazo[4,5-c]quinoline

Description:

1H-Imidazo[4,5-c]quinoline is a heterocyclic organic compound characterized by its fused imidazole and quinoline rings. This compound typically exhibits a pale yellow to brownish color and is known for its aromatic properties, which contribute to its stability and reactivity. It has a molecular formula that reflects its complex structure, incorporating nitrogen atoms within the ring system, which can influence its chemical behavior and interactions. 1H-Imidazo[4,5-c]quinoline is often studied for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. Its unique structure allows for various substitutions, which can enhance its pharmacological profile. Additionally, this compound may exhibit fluorescence, making it useful in certain analytical applications. The presence of nitrogen in the ring structure can also affect its solubility and interaction with other chemical species. Overall, 1H-Imidazo[4,5-c]quinoline is a versatile compound with significant implications in both research and potential therapeutic applications.

Formula: C₁₀H₇N₃

InChI: InChI=1S/C10H7N3/c1-2-4-8-7(3-1)10-9(5-11-8)12-6-13-10/h1-6H,(H,12,13)

InChI key: InChIKey=ITIRVXDSMXFTPW-UHFFFAOYSA-N

SMILES: C=12C=3C(N=CC1N=CN2)=CC=CC3

Synonyms:

• 3H-Imidazo[4,5-c]quinoline
• 1,3,5-Triaza-3H-benz[e]indene
• 1H-Imidazo[4,5-c]quinoline

1H-Imidazo[4,5-c]quinoline

CAS: 233-56-7

1H-Imidazo[4,5-c]quinoline is a hydrogen bond acceptor that can be used as an amide in pharmaceutical preparations. It has shown clinical development in the treatment of an infant with leukodystrophy. 1H-Imidazo[4,5-c]quinoline is also the first known example of a quinoline derivative that is orally active and has been shown to have monoclonal antibody binding activity. 1H-Imidazo[4,5-c]quinoline binds to the centroid of the T cell receptor and may work by stimulating or inhibiting T cell activation.
!-- END -->

Formula: C₁₀H₇N₃

Purity: Min. 95%

Molecular weight: 169.18 g/mol

Ref: 3D-AAA23356