CAS 233-88-5

1H-pyrrolo[3,2-h]quinoline

Description:

1H-pyrrolo[3,2-h]quinoline, with the CAS number 233-88-5, is a heterocyclic organic compound characterized by its fused pyrrole and quinoline structures. This compound typically exhibits a planar aromatic system, which contributes to its stability and potential electronic properties. It is known for its interesting biological activities, including potential applications in medicinal chemistry, particularly as a scaffold for drug development. The presence of nitrogen atoms in its structure can influence its reactivity and interaction with biological targets. Additionally, 1H-pyrrolo[3,2-h]quinoline may exhibit fluorescence, making it useful in various analytical applications. Its solubility can vary depending on the solvent, and it may participate in various chemical reactions, including electrophilic substitutions and cycloadditions. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₁₁H₈N₂

InChI: InChI=1/C11H8N2/c1-2-8-3-4-9-5-7-13-11(9)10(8)12-6-1/h1-7,13H

SMILES: c1cc2ccc3cc[nH]c3c2nc1

Synonyms:

• 1H-Pyrrolo[3,2-h]quinoline

1H-Pyrrolo[3,2-H]quinoline

CAS: 233-88-5

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 168.19900512695312

Ref: 10-F046393

1,9-Diaza-1H-benz[e]indene

CAS: 233-88-5

Formula: C₁₁H₈N₂

Molecular weight: 168.1946

Ref: IN-DA002MTJ

1H-Pyrrolo[3,2-h]quinoline

CAS: 233-88-5

1H-Pyrrolo[3,2-h]quinoline

Purity: 95%

Color and Shape: Pale Brown Solid

Molecular weight: 168.19g/mol

Ref: 54-OR318038