CAS 23302-83-2
:4-[(1-Methyl-4(1H)-pyridinylidene)ethylidene]-2,5-cyclohexadien-1-one
Description:
4-[(1-Methyl-4(1H)-pyridinylidene)ethylidene]-2,5-cyclohexadien-1-one, identified by its CAS number 23302-83-2, is an organic compound characterized by its complex structure that includes a pyridine ring and a cyclohexadienone moiety. This compound typically exhibits a yellow to orange coloration and is known for its potential applications in organic synthesis and as a dye or pigment due to its conjugated system, which can absorb visible light. The presence of the pyridine ring contributes to its aromatic properties, while the cyclohexadienone structure provides reactivity that can be exploited in various chemical reactions, such as electrophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility characteristics can vary depending on the solvent, and it may be sensitive to light and air, necessitating careful handling and storage. Overall, this compound represents a fascinating intersection of organic chemistry and potential practical applications.
Formula:C14H13NO
InChI:InChI=1S/C14H13NO/c1-15-10-8-13(9-11-15)3-2-12-4-6-14(16)7-5-12/h2-11H,1H3
InChI key:InChIKey=DBOHWMPKJCJANT-UHFFFAOYSA-N
SMILES:C(C=C1C=CN(C)C=C1)=C2C=CC(=O)C=C2
Synonyms:- 2,5-Cyclohexadien-1-one, 4-[(1-methyl-4(1H)-pyridylidene)ethylidene]-
- 4-[(1-Methyl-4(1H)-pyridinylidene)ethylidene]-2,5-cyclohexadien-1-one
- 2,5-Cyclohexadien-1-one, 4-[2-(1-methyl-4(1H)-pyridinylidene)ethylidene]-
- 2,5-Cyclohexadien-1-one, 4-[(1-methyl-4(1H)-pyridinylidene)ethylidene]-
- 4-[2-(1-Methyl-4(1H)-pyridinylidene)ethylidene]-2,5-cyclohexadien-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Brooker's merocyanine dye
CAS:Brooker's merocyanine dye is used as solvent polarity indicators. It is used as pH sensors and transition metal cation indicators. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacyFormula:C14H13NOColor and Shape:Red to dark maroon, SolidMolecular weight:211.261-Methyl-4-[(4-oxocyclohexadienylidene)ethylidene]-1,4-dihydropyridine
CAS:Formula:C14H13NOPurity:95%Color and Shape:SolidMolecular weight:211.25914-(2-(1-METHYLPYRIDIN-4(1H)-YLIDENE)ETHYLIDENE)CYCLOHEXA-2,5-DIEN-1-ONE
CAS:Purity:97.0%Color and Shape:Liquid, No data available.Molecular weight:211.26400756835938Brooker's merocyanine dye
CAS:Brooker's merocyanine dye is a fluorescent dye that has been used in analytical chemistry and fluorescence spectrometry. It is an organic compound that is soluble in water, alcohol, and ether. The complexation of Brooker's merocyanine dye with other molecules or solutes can be determined using fluorescence spectroscopy. This dye binds to the cavity of the molecule and stabilizes the dipole moment, which leads to significant interactions between Brooker's merocyanine dye and molecules or solutes.Formula:C14H13NOPurity:Min. 95%Molecular weight:211.26 g/mol



