
CAS 23304-24-7
:1-(Diazomethyl)-4-methylbenzene
Description:
1-(Diazomethyl)-4-methylbenzene, also known as p-tolyl diazomethane, is an organic compound characterized by the presence of a diazomethyl group (-N2CH2) attached to a para-methylphenyl ring. This compound typically appears as a yellow or orange liquid and is known for its reactivity due to the diazo functional group, which can participate in various chemical reactions, including cycloadditions and rearrangements. It is often used in organic synthesis as a reagent for the introduction of the diazo group into other compounds. The compound is sensitive to light and heat, which can lead to decomposition, and it should be handled with care due to its potential explosiveness under certain conditions. Additionally, 1-(Diazomethyl)-4-methylbenzene is soluble in organic solvents, making it useful in various synthetic applications. Safety precautions are essential when working with this compound, as diazo compounds can be hazardous.
Formula:C8H8N2
InChI:InChI=1S/C8H8N2/c1-7-2-4-8(5-3-7)6-10-9/h2-6H,1H3
InChI key:InChIKey=USJSQVRETVNKSA-UHFFFAOYSA-N
SMILES:C(=[N+]=[N-])C1=CC=C(C)C=C1
Synonyms:- p-(Diazomethyl)toluene
- 1-(Diazomethyl)-4-methylbenzene
- Benzene, 1-(diazomethyl)-4-methyl-
- p-Xylene, α-diazo-
- p-Tolyldiazomethane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
