CAS 23346-82-9
:2-bromo-3,4,5-trimethoxybenzoic acid
Description:
2-Bromo-3,4,5-trimethoxybenzoic acid is an aromatic compound characterized by the presence of a bromine atom and three methoxy groups attached to a benzoic acid framework. The methoxy groups (-OCH3) enhance the compound's solubility in organic solvents and influence its reactivity and electronic properties. The bromine substituent introduces a halogen, which can participate in various chemical reactions, such as nucleophilic substitution or coupling reactions. This compound typically exhibits moderate to high polarity due to the carboxylic acid functional group (-COOH), which can also engage in hydrogen bonding. The presence of multiple methoxy groups can affect the acidity of the carboxylic acid, potentially making it less acidic compared to unsubstituted benzoic acid. Additionally, the compound may exhibit interesting biological activities, making it of interest in pharmaceutical and chemical research. Its structural features suggest potential applications in organic synthesis and medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C10H11BrO5
InChI:InChI=1/C10H11BrO5/c1-14-6-4-5(10(12)13)7(11)9(16-3)8(6)15-2/h4H,1-3H3,(H,12,13)
SMILES:COc1cc(c(c(c1OC)OC)Br)C(=O)O
Synonyms:- Benzoic Acid, 2-Bromo-3,4,5-Trimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Bromo-3,4,5-Trimethoxybenzoic Acid
CAS:Controlled ProductFormula:C10H11BrO5Color and Shape:NeatMolecular weight:291.095

