CAS 23351-79-3
:Ethynyl-1-13Cbenzene
Description:
Ethynyl-1-^13Cbenzene, with the CAS number 23351-79-3, is a labeled compound used primarily in research and analytical chemistry. It is a derivative of ethynylbenzene, where one of the carbon atoms in the benzene ring is replaced with a carbon-13 isotope, making it useful for studies involving nuclear magnetic resonance (NMR) spectroscopy and other isotopic labeling techniques. The presence of the ethynyl group (-C≡CH) imparts unique reactivity, allowing for various chemical transformations, including polymerization and coupling reactions. Ethynyl-1-^13Cbenzene is typically a colorless liquid or solid, depending on the temperature, and is characterized by its aromatic properties, which contribute to its stability and reactivity. Its isotopic labeling aids in tracing pathways in chemical reactions and understanding molecular interactions. Safety precautions should be observed when handling this compound, as with many organic chemicals, due to potential toxicity and flammability.
Formula:C8H6
InChI:InChI=1S/C8H6/c1-2-8-6-4-3-5-7-8/h1,3-7H/i2+1
InChI key:InChIKey=UEXCJVNBTNXOEH-VQEHIDDOSA-N
SMILES:[13C](#C)C1=CC=CC=C1
Synonyms:- Phenyl[1-13C]acetylene
- Benzene, ethynyl-1-13C-
- Ethynyl-1-13Cbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
