CAS 23351-91-9
:5-Bromo-1,3-benzenedicarboxylic acid
Description:
5-Bromo-1,3-benzenedicarboxylic acid, with the CAS number 23351-91-9, is an aromatic compound characterized by the presence of two carboxylic acid groups (-COOH) and a bromine substituent on a benzene ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The bromine atom introduces a halogen functionality that can influence the compound's reactivity, making it useful in various chemical syntheses, including the preparation of pharmaceuticals and agrochemicals. The presence of two carboxylic acid groups allows for potential applications in coordination chemistry and as a building block in organic synthesis. Additionally, the compound may exhibit interesting properties such as acidity and the ability to form hydrogen bonds, which can affect its interactions in biological systems and materials science. Safety precautions should be observed when handling this compound, as with many brominated and carboxylic acid derivatives, due to potential toxicity and environmental concerns.
Formula:C8H5BrO4
InChI:InChI=1S/C8H5BrO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=JATKASGNRMGFSW-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C(O)=O)=CC(Br)=C1
Synonyms:- 1,3-Benzenedicarboxylic acid, 5-bromo-
- 5-Bromo-1,3-Benzenedicarboxylic Acid
- 5-Bromo-1,3-benzenedicarboxyic acid
- 5-Bromo-1,3-benzenedicarboxyicacid
- 5-Bromobenzene-1,3-Dicarboxylate
- 5-Bromobenzene-1,3-Dicarboxylic Acid
- Isophthalic acid, 5-bromo-
- 5-Bromoisophthalic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromoisophthalic Acid
CAS:Formula:C8H5BrO4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:245.031,3-Benzenedicarboxylic acid, 5-bromo-
CAS:Formula:C8H5BrO4Purity:97%Color and Shape:SolidMolecular weight:245.02695-Bromoisophthalic acid
CAS:5-Bromoisophthalic acidFormula:C8H5BrO4Purity:99%Color and Shape: off white solidMolecular weight:245.0269g/mol5-Bromoisophthalic acid
CAS:5-Bromoisophthalic acid is a chemical compound that belongs to the carboxylate group and has a molecular weight of 155.03. It is also known as 5-bromo-2,4-diphenyl ether and has a chemical formula of C6H4BrO2. This compound exhibits peroxidase-like activity and has been shown to be more stable than phenol in acidic solutions. The dipole moment of 5-bromoisophthalic acid is 0.7 D, indicating that it is an aromatic compound with a nonpolar region on one side and a polar region on the other side. 5-Bromoisophthalic acid can form hydrogen bonds with water molecules and other compounds, which affects its properties such as fluorescence properties.
Formula:C8H5BrO4Purity:Min. 95%Color and Shape:White PowderMolecular weight:245.03 g/mol




