CAS 23354-93-0
:Dithienylbutadiene
Description:
Dithienylbutadiene is an organic compound characterized by its unique structure, which consists of a butadiene core flanked by two thiophene rings. This compound exhibits interesting electronic properties due to the conjugated system formed by the alternating double bonds and the aromatic thiophene units. Dithienylbutadiene is typically a yellow to orange solid at room temperature and is known for its potential applications in organic electronics, such as organic photovoltaics and field-effect transistors, owing to its ability to facilitate charge transport. The compound is also studied for its photophysical properties, including fluorescence and absorption characteristics, which can be influenced by its molecular conformation and the presence of substituents. Additionally, dithienylbutadiene can undergo various chemical reactions, making it a versatile building block in organic synthesis. Its stability and reactivity can vary depending on the specific conditions and the presence of other functional groups. Overall, dithienylbutadiene represents a significant interest in materials science and organic chemistry due to its unique properties and potential applications.
Formula:C12H10S2
InChI:InChI=1/C12H10S2/c1(5-11-7-3-9-13-11)2-6-12-8-4-10-14-12/h1-10H/b5-1+,6-2+
Synonyms:- 1,4-Di(2-thienyl)-1,3-butadiene
- 2,2'-(1E,3E)-buta-1,3-diene-1,4-diyldithiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Thiophene, 2,2'-(1,3-butadiene-1,4-diyl)bis-
CAS:Formula:C12H10S2Purity:97.0%Color and Shape:SolidMolecular weight:218.33781,4-Di(2-thienyl)-1,3-butadiene (mixture of isomers)
CAS:1,4-Di(2-thienyl)-1,3-butadiene (mixture of isomers)Purity:>97.0%1,4-Di(2-thienyl)-1,3-butadiene (mixture of isomers)
CAS:Formula:C12H10S2Purity:>97.0%(GC)Color and Shape:Light yellow to Yellow to Green powder to crystalMolecular weight:218.33


