CAS 23358-95-4
:1,4-Benzenedicarboxylic acid, bis(4-hydroxybutyl) ester
Description:
1,4-Benzenedicarboxylic acid, bis(4-hydroxybutyl) ester, commonly known as bis(4-hydroxybutyl) terephthalate, is an organic compound characterized by its ester functional groups derived from terephthalic acid and 4-hydroxybutanol. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The presence of both aromatic and aliphatic structures contributes to its thermal stability and potential applications in polymer chemistry, particularly in the production of polyesters. Additionally, it exhibits good mechanical properties and can be utilized as a plasticizer or in the synthesis of various copolymers. The compound's structure allows for hydrogen bonding, which can influence its physical properties and interactions with other materials. Safety data indicates that, like many organic esters, it should be handled with care to avoid skin and eye contact, and appropriate safety measures should be taken during its use in industrial or laboratory settings.
Formula:C16H22O6
InChI:InChI=1S/C16H22O6/c17-9-1-3-11-21-15(19)13-5-7-14(8-6-13)16(20)22-12-4-2-10-18/h5-8,17-18H,1-4,9-12H2
InChI key:MRLFFZIIRRKXBJ-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)OCCCCO)C(=O)OCCCCO
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1,4-Benzenedicarboxylic acid, 1,4-bis(4-hydroxybutyl) ester
CAS:Formula:C16H22O6Purity:95%Color and Shape:SolidMolecular weight:310.3423Bis(4-hydroxybutyl) Terephthalate
CAS:Controlled ProductApplications Bis(4-hydroxybutyl) Terephthalate is an intermediate formed in the synthesis of Cyclotris(1,4-butylene Terephthalate) (C988975), a cyclic trimer of poly(butylene terephthalate), a thermoplastic engineering polymer.
References East, G.C. et al.: Polymer, 23, 323 (1982)Formula:C16H22O6Color and Shape:NeatMolecular weight:310.34Bis(4-hydroxybutyl) Terephthalate
CAS:Controlled ProductBis(4-hydroxybutyl) terephthalate is a chemical used as a reaction component in the production of polyesters. It can also be used as a reagent for the synthesis of other chemicals, such as pharmaceuticals. This compound is high quality, versatile and has many possible uses. It is also considered to be a speciality chemical, which means that it is only available from chemical suppliers and not from retail stores. CAS number: 23358-95-4
Formula:C16H22O6Purity:Min. 95%Color and Shape:PowderMolecular weight:310.34 g/mol




