CAS 23363-35-1
:4-Demethylepipodophyllotoxin 7′-O-β-D-glucopyranoside
Description:
4-Demethylepipodophyllotoxin 7′-O-β-D-glucopyranoside is a chemical compound derived from podophyllotoxin, a natural product obtained from the roots of the Podophyllum plant. This compound is characterized by its glycoside structure, which includes a glucopyranoside moiety attached to the 7′ position of the epipodophyllotoxin backbone. It exhibits notable biological activity, particularly in its potential as an anticancer agent, as it can inhibit cell division by interfering with microtubule dynamics. The compound is also of interest in medicinal chemistry due to its structural modifications that may enhance its therapeutic efficacy and reduce toxicity compared to its parent compound. Its solubility and stability in biological systems are influenced by the glycosylation, which can affect its pharmacokinetics and bioavailability. As a chemical entity, it is typically studied in the context of drug development and natural product chemistry, contributing to the understanding of plant-derived compounds in pharmacology.
Formula:C27H30O13
InChI:InChI=1S/C27H30O13/c1-34-16-3-10(4-17(35-2)21(16)29)19-11-5-14-15(38-9-37-14)6-12(11)25(13-8-36-26(33)20(13)19)40-27-24(32)23(31)22(30)18(7-28)39-27/h3-6,13,18-20,22-25,27-32H,7-9H2,1-2H3/t13-,18+,19+,20-,22+,23-,24+,25+,27-/m0/s1
InChI key:InChIKey=FOVRGQUEGRCWPD-BRLGUANISA-N
SMILES:O=C1[C@@]2([C@@H](C=3C([C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@]2(CO1)[H])=CC5=C(C3)OCO5)C6=CC(OC)=C(O)C(OC)=C6)[H]
Synonyms:- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 9-(β-D-glucopyranosyloxy)-5,8,8a,9-tetrahydro-5-(4-hydroxy-3,5-dimethoxyphenyl)-, [5R-(5α,5aβ,8aα,9β)]-
- Glucopyranoside, 4′-demethylepipodophyllotoxin, β-D-
- Epipodophyllotoxin, 4′-demethyl-, 9-β-D-glucopyranoside
- (5R,5aR,8aR,9S)-9-(β-D-Glucopyranosyloxy)-5,8,8a,9-tetrahydro-5-(4-hydroxy-3,5-dimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 9-(β-D-glucopyranosyloxy)-5,8,8a,9-tetrahydro-5-(4-hydroxy-3,5-dimethoxyphenyl)-, (5R,5aR,8aR,9S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Lignan P ((5R,5aR,8aR,9S)-9-(β-D-glucopyranosyloxy)-5-(4-hydroxy-3,5-dimethoxy phenyl) -5,8,8a,9 -tetrahydro[2]benzofuro-[5,6-f][1,3]benzodioxol-6(5aH)-one)
CAS:Lactones, nesoiFormula:C27H30O13Color and Shape:White PowderMolecular weight:562.168644'-demethylepipodophyllotoxin-9 β-glucopyranoside
CAS:Formula:C27H30O13Purity:98%Color and Shape:SolidMolecular weight:562.5193Etoposide EP Impurity D
CAS:Formula:C27H30O13Color and Shape:White To Off-White SolidMolecular weight:562.52Lignan P
CAS:Lignan P is a phytoestrogen product composed of plant-derived lignans, primarily sourced from flaxseeds and other lignan-rich seeds. These compounds are classified under a group of polyphenolic substances found in high concentrations within the seeds and are notable for their antioxidant properties. The mode of action of Lignan P involves its conversion into enterolignans by gut microbiota, which can mimic the function of human estrogens by binding to estrogen receptors, thereby influencing estrogenic activity within the body. This ability to interact with estrogen pathways makes Lignan P a potential candidate for modulating hormone-related processes.Formula:C27H30O13Purity:Min. 95%Molecular weight:562.5 g/mol







