CAS 23363-35-1: 4-Demethylepipodophyllotoxin 7′-O-β-D-glucopyranoside
Description:4-Demethylepipodophyllotoxin 7′-O-β-D-glucopyranoside is a chemical compound derived from podophyllotoxin, a natural product obtained from the roots of the Podophyllum plant. This compound is characterized by its glycoside structure, which includes a glucopyranoside moiety attached to the 7′ position of the epipodophyllotoxin backbone. It exhibits notable biological activity, particularly in its potential as an anticancer agent, as it can inhibit cell division by interfering with microtubule dynamics. The compound is also of interest in medicinal chemistry due to its structural modifications that may enhance its therapeutic efficacy and reduce toxicity compared to its parent compound. Its solubility and stability in biological systems are influenced by the glycosylation, which can affect its pharmacokinetics and bioavailability. As a chemical entity, it is typically studied in the context of drug development and natural product chemistry, contributing to the understanding of plant-derived compounds in pharmacology.
Formula:C27H30O13
InChI:InChI=1S/C27H30O13/c1-34-16-3-10(4-17(35-2)21(16)29)19-11-5-14-15(38-9-37-14)6-12(11)25(13-8-36-26(33)20(13)19)40-27-24(32)23(31)22(30)18(7-28)39-27/h3-6,13,18-20,22-25,27-32H,7-9H2,1-2H3/t13-,18+,19+,20-,22+,23-,24+,25+,27-/m0/s1
InChI key:InChIKey=FOVRGQUEGRCWPD-BRLGUANISA-N
SMILES:O=C1OCC2C(OC3OC(CO)C(O)C(O)C3O)C4=CC=5OCOC5C=C4C(C6=CC(OC)=C(O)C(OC)=C6)C12
- Synonyms:
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 9-(β-D-glucopyranosyloxy)-5,8,8a,9-tetrahydro-5-(4-hydroxy-3,5-dimethoxyphenyl)-, [5R-(5α,5aβ,8aα,9β)]-
- Glucopyranoside, 4′-demethylepipodophyllotoxin, β-D-
- Epipodophyllotoxin, 4′-demethyl-, 9-β-D-glucopyranoside
- (5R,5aR,8aR,9S)-9-(β-D-Glucopyranosyloxy)-5,8,8a,9-tetrahydro-5-(4-hydroxy-3,5-dimethoxyphenyl)furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one
- Furo[3′,4′:6,7]naphtho[2,3-d]-1,3-dioxol-6(5aH)-one, 9-(β-D-glucopyranosyloxy)-5,8,8a,9-tetrahydro-5-(4-hydroxy-3,5-dimethoxyphenyl)-, (5R,5aR,8aR,9S)-
