CAS 233665-96-8
:ethyl 3-(methylsulfanyl)butanoate
Description:
Ethyl 3-(methylsulfanyl)butanoate is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethyl alcohol) and a carboxylic acid (3-(methylsulfanyl)butanoic acid). This compound features a butanoate backbone with a methylsulfanyl group, which introduces a sulfur atom into its structure, potentially influencing its reactivity and properties. Ethyl 3-(methylsulfanyl)butanoate is typically a colorless to pale yellow liquid with a fruity or sweet odor, making it of interest in flavor and fragrance applications. Its molecular structure contributes to its solubility in organic solvents, while its boiling point and density can vary based on environmental conditions. The presence of the methylsulfanyl group may also impart unique characteristics, such as enhanced reactivity in certain chemical reactions or interactions with biological systems. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H14O2S
InChI:InChI=1/C7H14O2S/c1-4-9-7(8)5-6(2)10-3/h6H,4-5H2,1-3H3
SMILES:CCOC(=O)CC(C)SC
Synonyms:- Butanoic Acid, 3-(Methylthio)-, Ethyl Ester
- Butyric acid, 3-methylthio-, S-ethyl ester
- Ethyl 3-(methylthio)butyrate
- Ethyl 3-(methylsulfanyl)butanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
