
CAS 23370-16-3
:Chrysosplenol C
Description:
Chrysosplenol C, with the CAS number 23370-16-3, is a naturally occurring flavonoid compound primarily derived from various plant sources, particularly those in the genus *Chrysosplenium*. This compound is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Chrysosplenol C exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in pharmacological research. Its chemical structure typically includes multiple hydroxyl groups, which enhance its reactivity and ability to scavenge free radicals. Additionally, Chrysosplenol C is soluble in organic solvents, which facilitates its extraction from plant materials. The compound's potential health benefits and applications in natural product chemistry continue to be explored, highlighting its significance in both traditional medicine and modern therapeutic contexts. As with many flavonoids, its efficacy and safety profile are subjects of ongoing research, particularly regarding its mechanisms of action and bioavailability in biological systems.
Formula:C18H16O8
InChI:InChI=1S/C18H16O8/c1-23-10-6-8(4-5-9(10)19)17-18(25-3)16(22)13-11(26-17)7-12(24-2)14(20)15(13)21/h4-7,19-21H,1-3H3
InChI key:InChIKey=QQBSPLCHDUCBNM-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC=2C(C1=O)=C(O)C(O)=C(OC)C2)C3=CC(OC)=C(O)C=C3
Synonyms:- 5,6-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-
- Chrysosplenol C
- Flavone, 4′,5,6-trihydroxy-3,3′,7-trimethoxy-
- 5,6,4′-Trihydroxy-3,7,3′-trimethoxyflavone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4H-1-Benzopyran-4-one, 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-
CAS:Formula:C18H16O8Molecular weight:360.3148Chrysosplenol C
CAS:Chrysosplenol C is a natural product for research related to life sciences. The catalog number is TN6142 and the CAS number is 23370-16-3.Formula:C18H16O8Purity:98%Color and Shape:SolidMolecular weight:360.31Chrysosplenol C
CAS:Chrysosplenol C is a natural flavonoid compound, which is sourced primarily from various plant species known for their medicinal properties, such as Artemisia and Chrysosplenium. The mode of action of Chrysosplenol C involves modulation of enzyme activity and signaling pathways in biological systems, displaying anti-inflammatory, antioxidant, and antiproliferative effects. These biochemical mechanisms are due to its ability to interact with proteins and cellular structures, influencing cellular behaviors fundamental to various physiological processes.
Formula:C18H16O8Purity:Min. 95%Molecular weight:360.3 g/molRef: 3D-YAA37016
Discontinued product


