CAS 233770-01-9
:3-Bromo-5-iodo-pyridine
Description:
3-Bromo-5-iodo-pyridine is a heterocyclic organic compound characterized by the presence of both bromine and iodine substituents on a pyridine ring. The pyridine structure consists of a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and reactivity. The specific positions of the bromine and iodine atoms at the 3 and 5 positions, respectively, influence the compound's chemical properties, including its reactivity in nucleophilic substitution reactions and its potential as a building block in organic synthesis. This compound is typically used in medicinal chemistry and material science due to its ability to participate in various chemical reactions, such as cross-coupling reactions and electrophilic aromatic substitutions. Additionally, the presence of halogens can enhance the compound's lipophilicity and biological activity, making it of interest in drug development. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed.
Formula:C5H3BrIN
InChI:InChI=1/C5H3BrIN/c6-4-1-5(7)3-8-2-4/h1-3H
SMILES:c1c(cncc1I)Br
Synonyms:- 3-Bromo-5-Iodopyridine
- 5-Bromo-3-Iodopyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-5-iodopyridine, 95%
CAS:<p>Reactant in the synthesis chiral 4, 4?-Bipyridines. 3-bromo-5-(trifluoromethyl)pyridine is prepared from 3-Bromo-5-iodopyridine. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy br</p>Formula:C5H3BrINPurity:95%Molecular weight:283.89Pyridine, 3-bromo-5-iodo-
CAS:Formula:C5H3BrINPurity:90%Color and Shape:SolidMolecular weight:283.8925Ref: IN-DA002N02
1g25.00€5g55.00€10g71.00€25g136.00€50g180.00€100g314.00€250gTo inquire500gTo inquire3-Bromo-5-iodopyridine
CAS:3-Bromo-5-iodopyridineFormula:C5H3BrINPurity:≥95%Color and Shape: faint brown/beige flakesMolecular weight:283.89g/mol3-Bromo-5-iodopyridine
CAS:Formula:C5H3BrINPurity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:283.893-Bromo-5-iodopyridine
CAS:Formula:C5H3BrINPurity:90%Color and Shape:Solid, No data available.Molecular weight:283.894




