CAS 2338-20-7
:3,4,5-Triiodobenzoic acid
Description:
3,4,5-Triiodobenzoic acid is an aromatic compound characterized by the presence of three iodine atoms and a carboxylic acid group attached to a benzene ring. Its molecular formula is C7H3I3O2, reflecting the presence of iodine, hydrogen, carbon, and oxygen. This compound is typically a solid at room temperature and is known for its high molecular weight due to the heavy iodine atoms. It is often used in organic synthesis and as a reagent in various chemical reactions, particularly in the field of medicinal chemistry and radiology, where iodine's properties are beneficial. The presence of multiple iodine substituents significantly influences its chemical reactivity and physical properties, such as solubility and melting point. Additionally, 3,4,5-triiodobenzoic acid can exhibit biological activity, making it of interest in pharmacological studies. Safety precautions should be taken when handling this compound, as iodine can be hazardous in certain forms.
Formula:C7H3I3O2
InChI:InChI=1S/C7H3I3O2/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,(H,11,12)
InChI key:InChIKey=UCBKDZNMPMBJAB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(I)=C(I)C(I)=C1
Synonyms:- 3,4,5-Triiodobenzoate
- Ai3-27443
- Benzoic acid, 3,4,5-triiodo-
- Brn 2264330
- Nsc 11811
- 3,4,5-Triiodobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzoic acid, 3,4,5-triiodo-
CAS:Formula:C7H3I3O2Purity:%Color and Shape:SolidMolecular weight:499.81093,4,5-Triiodobenzoic acid
CAS:3,4,5-Triiodobenzoic acid is inhibitor of thiopurine methyltransferase (TPMT).Formula:C7H3I3O2Purity:99.77%Color and Shape:Almost White To Light Gray PowderMolecular weight:499.81093,4,5-Triiodobenzoic acid
CAS:3,4,5-Triiodobenzoic acid is a mesomeric molecule that has regulatory effects on root formation. It is an inhibitor of the transport of calcium ions and thereby inhibits the uptake of calcium by plant cells. 3,4,5-Triiodobenzoic acid also prevents the formation of intermolecular hydrogen bonds and molecular electrostatic potentials in biological studies. In addition, it has been shown to have a pH optimum of 6.0 and vibrational frequencies at 157 cm-1. This compound is used as a radiopaque contrast agent for X-ray imaging in muscle tissue.
Formula:C7H3I3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:499.81 g/mol




