CAS 2338-71-8
:5-fluoroindole-3-carboxaldehyde
Description:
5-Fluoroindole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position and an aldehyde functional group at the 3-position significantly influences its chemical properties and reactivity. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. The aldehyde group makes it a versatile intermediate for further chemical transformations, allowing for the synthesis of various derivatives. Additionally, the fluorine atom can enhance the compound's biological activity and lipophilicity, making it an interesting target for research in drug design. Its reactivity can be attributed to the electrophilic nature of the aldehyde, which can participate in condensation reactions and other nucleophilic attacks. Overall, 5-fluoroindole-3-carboxaldehyde is a valuable compound in organic synthesis and medicinal chemistry.
Formula:C9H6FNO
InChI:InChI=1/C9H6FNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H
SMILES:c1cc2c(cc1F)c(c[nH]2)C=O
Synonyms:- 5-Fluoro-3-formylindole
- 5-fluoro-1H-indole-3-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Fluoroindole-3-carboxaldehyde, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H6FNOPurity:98%Color and Shape:White to pale yellow to pale orange, PowderMolecular weight:163.151H-Indole-3-carboxaldehyde, 5-fluoro-
CAS:Formula:C9H6FNOPurity:98%Color and Shape:SolidMolecular weight:163.14845-Fluoro-1H-indole-3-carboxaldehyde
CAS:5-Fluoro-1H-indole-3-carboxaldehydeFormula:C9H6FNOPurity:≥95%Color and Shape: faint orange to light yellow crystalline solidMolecular weight:163.15g/mol5-Fluoroindole-3-carboxaldehyde
CAS:5-Fluoroindole-3-carboxaldehyde is a low molecular weight, water soluble, and stable chemical compound. It has a wide range of applications in the research field, including use as a versatile building block for complex compounds. This chemical is also used to synthesize useful intermediates and reaction components. 5-Fluoroindole-3-carboxaldehyde is a high quality reagent with many uses in research laboratories and produces no toxic byproducts.Formula:C9H6FNOPurity:Min. 99.0 Area-%Molecular weight:163.15 g/mol5-Fluoroindole-3-carboxaldehyde
CAS:Formula:C9H6FNOPurity:98%Color and Shape:Slightly off-white to slightly yellowish powderMolecular weight:163.151




