CymitQuimica logo

CAS 2339-59-5

:

4-Fluorobenzamidine

Description:
4-Fluorobenzamidine is an organic compound characterized by the presence of a fluorine atom attached to a benzene ring, along with an amidine functional group. Its molecular structure consists of a benzene ring substituted with a fluorine atom at the para position relative to the amidine group, which features a carbon-nitrogen double bond and a nitrogen atom bonded to a hydrogen atom. This compound is typically a white to off-white solid and is known for its role in various chemical reactions and applications, particularly in medicinal chemistry and as a building block for the synthesis of more complex molecules. 4-Fluorobenzamidine exhibits properties such as moderate solubility in polar solvents and can participate in hydrogen bonding due to the presence of the amidine group. Its reactivity is influenced by the electron-withdrawing nature of the fluorine atom, which can affect the compound's acidity and nucleophilicity. Overall, 4-Fluorobenzamidine is of interest in research for its potential biological activities and applications in drug development.
Formula:C7H7FN2
InChI:InChI=1S/C7H7FN2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H3,9,10)
InChI key:InChIKey=OSTGTIZRQZOYAH-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=CC=C(F)C=C1
Synonyms:
  • 4-Fluoro-Benzamidine Hcl H2O
  • 4-Fluorobenzamidine
  • 4-Fluorobenzamidine hydrochloride hydrate
  • 4-Fluorobenzenecarboximidamide
  • 4-fluorobenzenecarboximidamide hydrochloride Monohydrate
  • Benzamidine, p-fluoro-
  • Benzenecarboximidamide, 4-fluoro-
  • p-Fluorobenzamidine
Found 3 products.