CAS 23397-76-4
:1,2:5,6-Di-O-cyclohexylidene-alpha-D-glucofuranose
Description:
1,2:5,6-Di-O-cyclohexylidene-alpha-D-glucofuranose is a carbohydrate derivative characterized by its unique structure, which features two cyclohexylidene groups attached to the anomeric and hydroxyl positions of the glucose furanose ring. This compound is typically used in organic synthesis and carbohydrate chemistry due to its ability to protect hydroxyl groups, facilitating further chemical modifications. The cyclohexylidene groups enhance the stability and lipophilicity of the molecule, making it useful in various applications, including drug design and development. The compound is generally stable under standard laboratory conditions but may undergo hydrolysis in the presence of strong acids or bases. Its solubility is influenced by the presence of the bulky cyclohexylidene groups, which can affect its interactions with solvents and other reagents. As a derivative of glucose, it retains some of the biological properties of sugars, although its synthetic modifications may alter its reactivity and biological activity. Overall, 1,2:5,6-Di-O-cyclohexylidene-alpha-D-glucofuranose serves as an important tool in the field of synthetic organic chemistry.
Formula:C18H28O6
InChI:InChI=1/C18H28O6/c19-13-14(12-11-20-17(22-12)7-3-1-4-8-17)21-16-15(13)23-18(24-16)9-5-2-6-10-18/h12-16,19H,1-11H2/t12-,13+,14-,15-,16-/m1/s1
Synonyms:- (3a'R,5'S,6'S,6a'R)-5'-[(2R)-1,4-dioxaspiro[4.5]dec-2-yl]tetrahydrospiro[cyclohexane-1,2'-furo[2,3-d][1,3]dioxol]-6'-ol (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
α-D-Glucofuranose, 1,2:5,6-di-O-cyclohexylidene-
CAS:Formula:C18H28O6Purity:97%Color and Shape:SolidMolecular weight:340.41131,2:5,6-Di-O-Cyclohexylidene-α-D-Glucofuranose
CAS:1,2:5,6-Di-O-Cyclohexylidene-α-D-GlucofuranosePurity:97%1,2:5,6-Di-O-cyclohexylidene-α-D-glucofuranose
CAS:1,2:5,6-Di-O-cyclohexylidene-a-D-glucofuranose is a synthetic sugar which is used as a starting material for the synthesis of oligosaccharides and polysaccharides. This chemical is also used in the modification of glycosylation and carbohydrate. It can be used to synthesize high purity sugars, including monosaccharides and oligosaccharides. 1,2:5,6-Di-O-cyclohexylidene-a-D-glucofuranose is not fluorescent under UV light.Formula:C18H28O6Purity:Min. 95%Color and Shape:White PowderMolecular weight:340.41 g/mol




