CAS 23399-70-4

5-Chloro-2-iodotoluene

Description:

5-Chloro-2-iodotoluene is an organic compound characterized by the presence of both chlorine and iodine substituents on a toluene ring. Its molecular structure consists of a toluene backbone with a chlorine atom at the 5-position and an iodine atom at the 2-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its utility in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The presence of halogens in its structure can influence its reactivity, making it a valuable intermediate in nucleophilic substitution reactions. Additionally, 5-chloro-2-iodotoluene may exhibit specific physical properties such as boiling and melting points that are influenced by the halogen substituents. As with many halogenated compounds, it is important to handle this substance with care due to potential toxicity and environmental concerns associated with halogenated organic compounds. Proper safety protocols should be followed when working with this chemical.

Formula: C₇H₆ClI

InChI: InChI=1/C7H6ClI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3

SMILES: Cc1cc(ccc1I)Cl

Synonyms:

• 4-Chloro-1-Iodo-2-Methylbenzene
• 2-Iodo-5-chlorotoluene

Benzene, 4-chloro-1-iodo-2-methyl-

CAS: 23399-70-4

Formula: C₇H₆ClI

Purity: 98%

Color and Shape: Liquid

Molecular weight: 252.4800

Ref: IN-DA002N2W

5-Chloro-2-iodotoluene

CAS: 23399-70-4

5-Chloro-2-iodotoluene

Purity: 97%

Color and Shape: Liquid

Molecular weight: 252.48g/mol

Ref: 54-OR0133

5-Chloro-2-iodotoluene

CAS: 23399-70-4

Formula: C₇H₆ClI

Purity: 98%

Color and Shape: Liquid

Molecular weight: 252.48

Ref: 10-F018386

5-Chloro-2-iodotoluene

CAS: 23399-70-4

5-Chloro-2-iodotoluene is a versatile compound that finds applications in various industries. It is commonly used in pharmaceutical preparations, zeolite synthesis, and as a catalyst in organic synthesis. This compound has been found to exhibit carbonic anhydrase inhibitory activity, making it potentially useful in the development of medicaments for conditions related to this enzyme. Additionally, 5-Chloro-2-iodotoluene has shown potential as a growth factor for certain cell types. Its unique properties make it an essential component in research chemicals and industrial processes. With its wide range of applications, this compound plays a crucial role in diverse fields.

Formula: C₇H₆ClI

Purity: Min. 95%

Molecular weight: 252.48 g/mol

Ref: 3D-YAA39970