CymitQuimica logo

CAS 23399-77-1

:

4-Chloro-1-iodo-2-(trifluoromethyl)benzene

Description:
4-Chloro-1-iodo-2-(trifluoromethyl)benzene, with the CAS number 23399-77-1, is an aromatic halogenated compound characterized by the presence of chlorine, iodine, and a trifluoromethyl group attached to a benzene ring. This compound features a chlorinated and iodinated aromatic system, which can influence its reactivity and physical properties. The trifluoromethyl group is known for its electron-withdrawing effects, which can enhance the compound's electrophilicity and alter its chemical behavior in reactions. Typically, such compounds exhibit moderate to high stability under standard conditions but may undergo nucleophilic substitution or electrophilic aromatic substitution reactions. The presence of halogens can also impart unique properties, such as increased lipophilicity and potential bioactivity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the arrangement of substituents on the benzene ring and the overall molecular structure.
Formula:C7H3ClF3I
InChI:InChI=1S/C7H3ClF3I/c8-4-1-2-6(12)5(3-4)7(9,10)11/h1-3H
InChI key:InChIKey=DRMQJFVDZWIKTE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(I)C=CC(Cl)=C1
Synonyms:
  • 2-Iodo-5-chlorobenzotrifluoride
  • 4-Chloro-1-iodo-2-trifluoromethylbenzene
  • 4-Chloro-2-(trifluoromethyl)iodobenzene
  • 5-Chloro-2-Iodobenzotrifluoride
  • Benzene, 4-chloro-1-iodo-2-(trifluoromethyl)-
  • Toluene, 5-chloro-α,α,α-trifluoro-2-iodo-
  • 4-Chloro-1-iodo-2-(trifluoromethyl)benzene
Found 5 products.