CymitQuimica logo

CAS 234-80-0

:

[1,2,4]triazolo[3,4-a]phthalazine

Description:
[1,2,4]Triazolo[3,4-a]phthalazine is a heterocyclic compound characterized by its fused triazole and phthalazine rings. This compound features a triazole ring, which consists of three nitrogen atoms and two carbon atoms, fused to a phthalazine structure, a bicyclic compound containing two fused benzene rings. The presence of nitrogen in the triazole ring contributes to its unique chemical properties, including potential reactivity and solubility in various solvents. [1,2,4]Triazolo[3,4-a]phthalazine is often studied for its biological activities, including potential applications in pharmaceuticals due to its ability to interact with biological targets. Its structure allows for various substitution patterns, which can influence its chemical behavior and biological efficacy. Additionally, this compound may exhibit interesting photophysical properties, making it a subject of interest in materials science and organic electronics. Overall, [1,2,4]triazolo[3,4-a]phthalazine is a versatile compound with significant implications in both medicinal chemistry and materials research.
Formula:C9H6N4
InChI:InChI=1/C9H6N4/c1-2-4-8-7(3-1)5-11-13-6-10-12-9(8)13/h1-6H
SMILES:c1ccc2c(c1)cnn1cnnc21
Synonyms:
  • 1,2,4-Triazolo(3,4-a)phthalazine (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.