CymitQuimica logo

CAS 234081-94-8

:

Octanedioic acid, mono(1,1-dimethylethyl) ester

Description:
Octanedioic acid, mono(1,1-dimethylethyl) ester, also known as diethyl sebacate, is an ester derived from octanedioic acid (sebacic acid) and 1,1-dimethylethanol. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. The ester functional group contributes to its reactivity, making it susceptible to hydrolysis under acidic or basic conditions. Octanedioic acid, mono(1,1-dimethylethyl) ester is often used in the production of plasticizers, lubricants, and as an intermediate in organic synthesis. Its low volatility and thermal stability make it suitable for various industrial applications. Additionally, it exhibits low toxicity, which enhances its appeal for use in consumer products. As with many esters, it may undergo transesterification reactions, allowing for further modifications in chemical synthesis. Overall, this compound is valued for its functional properties in both chemical and industrial contexts.
Formula:C12H22O4
InChI:InChI=1S/C12H22O4/c1-12(2,3)16-11(15)9-7-5-4-6-8-10(13)14/h4-9H2,1-3H3,(H,13,14)
InChI key:BONUHUQZCZQQEN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)CCCCCCC(=O)O
Found 5 products.