CAS 234082-35-0
:Benzoic acid, 3-chloro-4-fluoro-, methyl ester
Description:
Benzoic acid, 3-chloro-4-fluoro-, methyl ester, identified by the CAS number 234082-35-0, is an organic compound characterized by its ester functional group, which is formed from benzoic acid and methanol. This compound features a benzene ring substituted with both a chlorine atom at the 3-position and a fluorine atom at the 4-position, contributing to its unique chemical properties. The presence of these halogen substituents can influence the compound's reactivity, polarity, and solubility in various solvents. Typically, esters like this one are known for their pleasant odors and are often used in flavoring and fragrance applications. Additionally, the specific arrangement of substituents can affect the compound's biological activity and potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the realm of substituted aromatic compounds.
Formula:C8H6ClFO2
InChI:InChI=1S/C8H6ClFO2/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4H,1H3
InChI key:InChIKey=RUTYNTBIMOCJMW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(Cl)=C(F)C=C1
Synonyms:- 3-Chloro-4-fluoro Methyl benzoate
- 3-Chloro-4-fluorobenzoic acid methyl ester
- Benzoic Acid, 3-Chloro-4-Fluoro-, Methyl Ester
- Methyl 3-chloro-4-fluorobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3-chloro-4-fluoro-, methyl ester
CAS:Formula:C8H6ClFO2Purity:98%Color and Shape:SolidMolecular weight:188.5834Methyl 3-chloro-4-fluorobenzoate
CAS:Methyl 3-chloro-4-fluorobenzoatePurity:99%Molecular weight:188.58g/molMethyl 3-chloro-4-fluorobenzoate
CAS:Formula:C8H6ClFO2Purity:98%Color and Shape:Solid, Low Melting SolidMolecular weight:188.58Methyl 3-chloro-4-fluorobenzoate
CAS:Methyl 3-chloro-4-fluorobenzoate is a white crystalline solid with a melting point of 61°C. It is soluble in ethyl acetate, ether, and chloroform. Methyl 3-chloro-4-fluorobenzoate is used as a reagent in the synthesis of polymers, pharmaceuticals, and pesticides. It has been shown to be useful as a building block for the synthesis of complex compounds such as heterocycles and polymers. Methyl 3-chloro-4-fluorobenzoate is also used as an intermediate in the production of other chemicals such as pharmaceuticals, catalysts, and herbicides.Formula:C8H6ClFO2Purity:Min. 95%Molecular weight:188.58 g/mol



