CAS 234107-53-0

6-Chlorobenzo[b]thiophene-2-methanol

Description:

6-Chlorobenzo[b]thiophene-2-methanol is an organic compound characterized by its unique structure, which includes a chlorinated benzo[b]thiophene moiety and a hydroxymethyl group. This compound features a chlorine atom at the 6-position of the benzo[b]thiophene ring, contributing to its reactivity and potential applications in various chemical reactions. The presence of the hydroxymethyl group at the 2-position enhances its solubility in polar solvents and may influence its biological activity. Typically, compounds of this nature are studied for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure allows for various functionalization possibilities, making it a versatile building block in synthetic chemistry. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 6-Chlorobenzo[b]thiophene-2-methanol represents a significant compound in the field of organic chemistry, with potential implications in medicinal chemistry and material science.

Formula: C₉H₇ClOS

InChI: InChI=1S/C9H7ClOS/c10-7-2-1-6-3-8(5-11)12-9(6)4-7/h1-4,11H,5H2

InChI key: InChIKey=VGQQRAFINZGCNU-UHFFFAOYSA-N

SMILES: C(O)C1=CC=2C(S1)=CC(Cl)=CC2

Synonyms:

• (6-Chlorobenz[b]thiophen-2-yl)methanol
• Benzo[b]thiophene-2-methanol, 6-chloro-
• (6-Chlorobenzo[b]thiophen-2-yl)methanol
• 6-Chlorobenzo[b]thiophene-2-methanol
• (6-Chloro-1-benzothiophen-2-yl)methanol

(6-chloro-1-benzothiophen-2-yl)methanol

CAS: 234107-53-0

Formula: C₉H₇ClOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 198.6693

Ref: IN-DA00BH00

(6-Chlorobenzo[b]thiophen-2-yl)methanol

CAS: 234107-53-0

Formula: C₉H₇ClOS

Purity: 95.0%

Molecular weight: 198.66

Ref: 10-F442171