
CAS 23411-45-2
:Nickel, tetrakis(isocyanobenzene)-
Description:
Nickel, tetrakis(isocyanobenzene)-, with the CAS number 23411-45-2, is a coordination compound featuring nickel as the central metal ion coordinated to four isocyanobenzene ligands. This compound typically exhibits a square planar geometry, which is common for nickel(II) complexes. The isocyanobenzene ligands contribute to the overall stability and electronic properties of the complex, often influencing its reactivity and interaction with other chemical species. Nickel complexes are known for their catalytic properties and can participate in various chemical reactions, including those in organic synthesis and materials science. The presence of isocyanobenzene ligands may also impart unique optical or electronic characteristics, making such compounds of interest in fields like coordination chemistry and materials development. Additionally, the compound's solubility, thermal stability, and potential toxicity should be considered when handling or utilizing it in research or industrial applications. As with many nickel compounds, appropriate safety measures should be observed due to potential health risks associated with nickel exposure.
Formula:C28H20N4Ni
InChI:InChI=1S/4C7H5N.Ni/c4*1-8-7-5-3-2-4-6-7;/h4*2-6H;
InChI key:InChIKey=HASXBTIKSMESND-UHFFFAOYSA-N
SMILES:[Ni]([C-]#[N+]C1=CC=CC=C1)([C-]#[N+]C2=CC=CC=C2)([C-]#[N+]C3=CC=CC=C3)[C-]#[N+]C4=CC=CC=C4
Synonyms:- Nickel, tetrakis(phenyl isocyanide)-
- Nickel, tetrakis(isocyanobenzene)-
- Benzene, isocyano-, nickel complex
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
