CAS 234111-08-1
:2-Bromo-6-iodopyridine
Description:
2-Bromo-6-iodopyridine is a heterocyclic organic compound characterized by the presence of both bromine and iodine substituents on a pyridine ring. This compound features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and reactivity. The bromine and iodine atoms are located at the 2 and 6 positions, respectively, influencing the compound's electronic properties and steric hindrance. 2-Bromo-6-iodopyridine is typically a solid at room temperature and is soluble in organic solvents, making it useful in various chemical reactions, particularly in the synthesis of more complex organic molecules. Its halogen substituents can participate in nucleophilic substitution reactions, making it a valuable intermediate in medicinal chemistry and material science. Additionally, the presence of multiple halogens can enhance its reactivity and facilitate further functionalization, which is advantageous in the development of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound due to the potential hazards associated with halogenated organic compounds.
Formula:C5H3BrIN
InChI:InChI=1/C5H3BrIN/c6-4-2-1-3-5(7)8-4/h1-3H
SMILES:c1cc(Br)nc(c1)I
Synonyms:- Pyridine, 2-Bromo-6-Iodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromo-6-iodopyridine
CAS:Formula:C5H3BrINPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:283.892-Bromo-6-iodopyridine, 97%
CAS:<p>6-trifluoromethyl-2-pyridinecarboxylic acid (4; 87%) was obtained from 2-bromo-6-(trifluoromethyl)pyridine, which was in turn derived from 2-bromo-6-iodopyridine by trifluoromethylating displacement of iodine.This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar produc</p>Formula:C5H3BrINPurity:97%Color and Shape:Crystals or powder or crystalline powder, White to cream to brownMolecular weight:283.89Pyridine, 2-bromo-6-iodo-
CAS:Formula:C5H3BrINPurity:98%Color and Shape:SolidMolecular weight:283.89252-Bromo-6-iodopyridine
CAS:2-Bromo-6-iodopyridineFormula:C5H3BrINPurity:98%Color and Shape: white solidMolecular weight:283.89g/mol2-Bromo-6-iodopyridine
CAS:Formula:C5H3BrINPurity:97%Color and Shape:Solid, Yellow powderMolecular weight:283.894




